C24H44O4 — CID 54122285
ethyl 2-ethyl-7-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyoctyl)cyclopentyl]hept-2-enoate (PubChem CID 54122285) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is ethyl 2-ethyl-7-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyoctyl)cyclopentyl]hept-2-enoate.
| Compound Name | ethyl 2-ethyl-7-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyoctyl)cyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 54122285 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | ethyl 2-ethyl-7-[(1R,2S,5S)-2-hydroxy-5-(3-hydroxyoctyl)cyclopentyl]hept-2-enoate |
| SMILES | CCCCCC(O)CC[C@H]1CC[C@H](O)[C@@H]1CCCCC=C(CC)C(=O)OCC |
| InChI | InChI=1S/C24H44O4/c1-4-7-9-13-21(25)17-15-20-16-18-23(26)22(20)14-11-8-10-12-19(5-2)24(27)28-6-3/h12,20-23,25-26H,4-11,13-18H2,1-3H3/t20-,21?,22+,23-/m0/s1 |
| InChIKey | NONZWDAPKVSPTD-FXHBAXTJSA-N |
| XLogP | 5.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|