About methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate
methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate (PubChem CID 54122499) has the molecular formula C9H13NO5
and a molecular weight of 215.20 g/mol. Its IUPAC name is methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate |
| PubChem CID | 54122499 |
| Molecular Formula | C9H13NO5 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate |
| SMILES | COC(=O)CC1=NC(C)(CO)COC1=O |
| InChI | InChI=1S/C9H13NO5/c1-9(4-11)5-15-8(13)6(10-9)3-7(12)14-2/h11H,3-5H2,1-2H3 |
| InChIKey | NOSKPLVTGGNXML-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate?
The IUPAC name of methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate (CID 54122499) is methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate.
What is the SMILES notation for methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate?
The canonical SMILES for methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate is COC(=O)CC1=NC(C)(CO)COC1=O.
What is the InChIKey of methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate?
The InChIKey is NOSKPLVTGGNXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5/c1-9(4-11)5-15-8(13)6(10-9)3-7(12)14-2/h11H,3-5H2,1-2H3.
What are the key properties of methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate?
methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate has a molecular weight of 215.20 g/mol, XLogP of -0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(hydroxymethyl)-3-methyl-6-oxo-2H-1,4-oxazin-5-yl]acetate is sourced from PubChem (CID 54122499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).