About ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate
ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate (PubChem CID 54122775) has the molecular formula C28H46O6
and a molecular weight of 478.67 g/mol. Its IUPAC name is ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate.
Molecular Properties
| Compound Name | ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate |
| PubChem CID | 54122775 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate |
| SMILES | CCCCC(CC)C(=CC=C1CC[C@@H](OC(C)=O)[C@@H]1CCCCCCC(=O)OCC)OC(C)=O |
| InChI | InChI=1S/C28H46O6/c1-6-9-14-23(7-2)26(33-21(4)29)19-17-24-18-20-27(34-22(5)30)25(24)15-12-10-11-13-16-28(31)32-8-3/h17,19,23,25,27H,6-16,18,20H2,1-5H3/t23?,25-,27-/m1/s1 |
| InChIKey | NOWRRJDFKMNXDK-APMJBHHHSA-N |
| XLogP | 6.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate?
The IUPAC name of ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate (CID 54122775) is ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate.
What is the SMILES notation for ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate?
The canonical SMILES for ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate is CCCCC(CC)C(=CC=C1CC[C@@H](OC(C)=O)[C@@H]1CCCCCCC(=O)OCC)OC(C)=O.
What is the InChIKey of ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate?
The InChIKey is NOWRRJDFKMNXDK-APMJBHHHSA-N. The full InChI is InChI=1S/C28H46O6/c1-6-9-14-23(7-2)26(33-21(4)29)19-17-24-18-20-27(34-22(5)30)25(24)15-12-10-11-13-16-28(31)32-8-3/h17,19,23,25,27H,6-16,18,20H2,1-5H3/t23?,25-,27-/m1/s1.
What are the key properties of ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate?
ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate has a molecular weight of 478.67 g/mol, XLogP of 6.82, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[(1R,2R)-2-acetyloxy-5-(3-acetyloxy-4-ethyloct-2-enylidene)cyclopentyl]heptanoate is sourced from PubChem (CID 54122775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).