C3HCl7O — CID 54123336
1,1,2,2,3,3,3-heptachloropropan-1-ol (PubChem CID 54123336) has the molecular formula C3HCl7O and a molecular weight of 301.21 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptachloropropan-1-ol.
| Compound Name | 1,1,2,2,3,3,3-heptachloropropan-1-ol |
|---|---|
| PubChem CID | 54123336 |
| Molecular Formula | C3HCl7O |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 297.78 |
| IUPAC Name | 1,1,2,2,3,3,3-heptachloropropan-1-ol |
| SMILES | OC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C3HCl7O/c4-1(5,2(6,7)8)3(9,10)11/h11H |
| InChIKey | FHICVGFSEYFIJV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|