About 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione
1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione (PubChem CID 54123646) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione |
| PubChem CID | 54123646 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione |
| SMILES | C=C1CC(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C7H10N2O2/c1-5-4-6(10)9(3)7(11)8(5)2/h1,4H2,2-3H3 |
| InChIKey | NPLWOCFLWYHQTK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione?
The IUPAC name of 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione (CID 54123646) is 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione.
What is the SMILES notation for 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione?
The canonical SMILES for 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione is C=C1CC(=O)N(C)C(=O)N1C.
What is the InChIKey of 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione?
The InChIKey is NPLWOCFLWYHQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-4-6(10)9(3)7(11)8(5)2/h1,4H2,2-3H3.
What are the key properties of 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione?
1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione has a molecular weight of 154.17 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-methylidene-1,3-diazinane-2,4-dione is sourced from PubChem (CID 54123646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).