C12H19NO4 — CID 54123942
(2S,3R)-2-(4-ethylhexa-2,4-dienoylamino)-3-hydroxybutanoic acid (PubChem CID 54123942) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2S,3R)-2-(4-ethylhexa-2,4-dienoylamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(4-ethylhexa-2,4-dienoylamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 54123942 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2S,3R)-2-(4-ethylhexa-2,4-dienoylamino)-3-hydroxybutanoic acid |
| SMILES | CC=C(C=CC(=O)N[C@H](C(=O)O)[C@@H](C)O)CC |
| InChI | InChI=1S/C12H19NO4/c1-4-9(5-2)6-7-10(15)13-11(8(3)14)12(16)17/h4,6-8,11,14H,5H2,1-3H3,(H,13,15)(H,16,17)/t8-,11+/m1/s1 |
| InChIKey | NPQQHQVKJHLTJC-KCJUWKMLSA-N |
| XLogP | 0.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|