About 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate
3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate (PubChem CID 54124449) has the molecular formula C13H34N2O6S2
and a molecular weight of 378.56 g/mol. Its IUPAC name is 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate.
Molecular Properties
| Compound Name | 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate |
| PubChem CID | 54124449 |
| Molecular Formula | C13H34N2O6S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate |
| SMILES | CC.C[N+](C)(C)CCCS(=O)(=O)[O-].C[NH+](C)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H15NO3S.C5H13NO3S.C2H6/c1-7(2,3)5-4-6-11(8,9)10;1-6(2)4-3-5-10(7,8)9;1-2/h4-6H2,1-3H3;3-5H2,1-2H3,(H,7,8,9);1-2H3 |
| InChIKey | NPZAUZBCEWTMBL-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate?
The IUPAC name of 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate (CID 54124449) is 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate.
What is the SMILES notation for 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate?
The canonical SMILES for 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate is CC.C[N+](C)(C)CCCS(=O)(=O)[O-].C[NH+](C)CCCS(=O)(=O)[O-].
What is the InChIKey of 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate?
The InChIKey is NPZAUZBCEWTMBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3S.C5H13NO3S.C2H6/c1-7(2,3)5-4-6-11(8,9)10;1-6(2)4-3-5-10(7,8)9;1-2/h4-6H2,1-3H3;3-5H2,1-2H3,(H,7,8,9);1-2H3.
What are the key properties of 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate?
3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate has a molecular weight of 378.56 g/mol, XLogP of -1.28, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylazaniumyl)propane-1-sulfonate;ethane;3-(trimethylazaniumyl)propane-1-sulfonate is sourced from PubChem (CID 54124449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).