About 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one
1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one (PubChem CID 54125661) has the molecular formula C30H33N3O
and a molecular weight of 451.61 g/mol. Its IUPAC name is 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one.
Molecular Properties
| Compound Name | 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one |
| PubChem CID | 54125661 |
| Molecular Formula | C30H33N3O |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one |
| SMILES | CN(C)c1ccc(C=C2CN(Cc3ccccc3)CC(=Cc3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H33N3O/c1-31(2)28-14-10-23(11-15-28)18-26-21-33(20-25-8-6-5-7-9-25)22-27(30(26)34)19-24-12-16-29(17-13-24)32(3)4/h5-19H,20-22H2,1-4H3 |
| InChIKey | NQTTYYJHLXXACE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one?
The IUPAC name of 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one (CID 54125661) is 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one.
What is the SMILES notation for 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one?
The canonical SMILES for 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one is CN(C)c1ccc(C=C2CN(Cc3ccccc3)CC(=Cc3ccc(N(C)C)cc3)C2=O)cc1.
What is the InChIKey of 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one?
The InChIKey is NQTTYYJHLXXACE-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H33N3O/c1-31(2)28-14-10-23(11-15-28)18-26-21-33(20-25-8-6-5-7-9-25)22-27(30(26)34)19-24-12-16-29(17-13-24)32(3)4/h5-19H,20-22H2,1-4H3.
What are the key properties of 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one?
1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one has a molecular weight of 451.61 g/mol, XLogP of 5.37, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one is sourced from PubChem (CID 54125661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).