C6H7BrN2O3 — CID 54126789
5-(2-bromo-1-nitrosoethyl)-3-methoxy-1,2-oxazole (PubChem CID 54126789) has the molecular formula C6H7BrN2O3 and a molecular weight of 235.04 g/mol. Its IUPAC name is 5-(2-bromo-1-nitrosoethyl)-3-methoxy-1,2-oxazole.
| Compound Name | 5-(2-bromo-1-nitrosoethyl)-3-methoxy-1,2-oxazole |
|---|---|
| PubChem CID | 54126789 |
| Molecular Formula | C6H7BrN2O3 |
| Molecular Weight | 235.04 g/mol |
| Exact Mass | 233.96 |
| IUPAC Name | 5-(2-bromo-1-nitrosoethyl)-3-methoxy-1,2-oxazole |
| SMILES | COc1cc(C(CBr)N=O)on1 |
| InChI | InChI=1S/C6H7BrN2O3/c1-11-6-2-5(12-9-6)4(3-7)8-10/h2,4H,3H2,1H3 |
| InChIKey | NRNHLKNWZIXJFZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.04 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|