About N-but-2-enylacetamide
N-but-2-enylacetamide (PubChem CID 54126793) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is N-but-2-enylacetamide.
Molecular Properties
| Compound Name | N-but-2-enylacetamide |
| PubChem CID | 54126793 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | N-but-2-enylacetamide |
| SMILES | CC=CCNC(C)=O |
| InChI | InChI=1S/C6H11NO/c1-3-4-5-7-6(2)8/h3-4H,5H2,1-2H3,(H,7,8) |
| InChIKey | NRNINBJEUSDBSL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-but-2-enylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-enylacetamide?
The IUPAC name of N-but-2-enylacetamide (CID 54126793) is N-but-2-enylacetamide.
What is the SMILES notation for N-but-2-enylacetamide?
The canonical SMILES for N-but-2-enylacetamide is CC=CCNC(C)=O.
What is the InChIKey of N-but-2-enylacetamide?
The InChIKey is NRNINBJEUSDBSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-3-4-5-7-6(2)8/h3-4H,5H2,1-2H3,(H,7,8).
What are the key properties of N-but-2-enylacetamide?
N-but-2-enylacetamide has a molecular weight of 113.16 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-enylacetamide is sourced from PubChem (CID 54126793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).