C20H18N4O2S — CID 54126878
4-[5-cyano-4-(4-methylphenyl)-1-prop-2-enylpyrazol-3-yl]benzenesulfonamide (PubChem CID 54126878) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 4-[5-cyano-4-(4-methylphenyl)-1-prop-2-enylpyrazol-3-yl]benzenesulfonamide.
| Compound Name | 4-[5-cyano-4-(4-methylphenyl)-1-prop-2-enylpyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 54126878 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-[5-cyano-4-(4-methylphenyl)-1-prop-2-enylpyrazol-3-yl]benzenesulfonamide |
| SMILES | C=CCn1nc(-c2ccc(S(N)(=O)=O)cc2)c(-c2ccc(C)cc2)c1C#N |
| InChI | InChI=1S/C20H18N4O2S/c1-3-12-24-18(13-21)19(15-6-4-14(2)5-7-15)20(23-24)16-8-10-17(11-9-16)27(22,25)26/h3-11H,1,12H2,2H3,(H2,22,25,26) |
| InChIKey | NROXORDBKCTJMF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|