C14H20N4O4 — CID 54127917
2,3-bis[[(2S)-azetidin-2-yl]methoxy]-6-methyl-5-nitropyridine (PubChem CID 54127917) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2,3-bis[[(2S)-azetidin-2-yl]methoxy]-6-methyl-5-nitropyridine.
| Compound Name | 2,3-bis[[(2S)-azetidin-2-yl]methoxy]-6-methyl-5-nitropyridine |
|---|---|
| PubChem CID | 54127917 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2,3-bis[[(2S)-azetidin-2-yl]methoxy]-6-methyl-5-nitropyridine |
| SMILES | Cc1nc(OC[C@@H]2CCN2)c(OC[C@@H]2CCN2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O4/c1-9-12(18(19)20)6-13(21-7-10-2-4-15-10)14(17-9)22-8-11-3-5-16-11/h6,10-11,15-16H,2-5,7-8H2,1H3/t10-,11-/m0/s1 |
| InChIKey | NSGWFNJJCXVMSK-QWRGUYRKSA-N |
| XLogP | 0.78 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|