C24H23NO5S2 — CID 54128287
ethyl 4-(2-benzylsulfinylsulfanylphenyl)-2-methyl-5-oxo-4,7-dihydro-3H-furo[3,4-b]pyridine-3-carboxylate (PubChem CID 54128287) has the molecular formula C24H23NO5S2 and a molecular weight of 469.58 g/mol. Its IUPAC name is ethyl 4-(2-benzylsulfinylsulfanylphenyl)-2-methyl-5-oxo-4,7-dihydro-3H-furo[3,4-b]pyridine-3-carboxylate.
| Compound Name | ethyl 4-(2-benzylsulfinylsulfanylphenyl)-2-methyl-5-oxo-4,7-dihydro-3H-furo[3,4-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54128287 |
| Molecular Formula | C24H23NO5S2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | ethyl 4-(2-benzylsulfinylsulfanylphenyl)-2-methyl-5-oxo-4,7-dihydro-3H-furo[3,4-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1C(C)=NC2=C(C(=O)OC2)C1c1ccccc1SS(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H23NO5S2/c1-3-29-23(26)20-15(2)25-18-13-30-24(27)22(18)21(20)17-11-7-8-12-19(17)31-32(28)14-16-9-5-4-6-10-16/h4-12,20-21H,3,13-14H2,1-2H3 |
| InChIKey | NSMYILMYZMRGPI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|