C15H21O5P — CID 54128377
[1-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-1-phenylethyl] acetate (PubChem CID 54128377) has the molecular formula C15H21O5P and a molecular weight of 312.30 g/mol. Its IUPAC name is [1-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-1-phenylethyl] acetate.
| Compound Name | [1-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 54128377 |
| Molecular Formula | C15H21O5P |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [1-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)-1-phenylethyl] acetate |
| SMILES | CC(=O)OC(C)(c1ccccc1)P1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C15H21O5P/c1-12(16)20-15(4,13-8-6-5-7-9-13)21(17)18-10-14(2,3)11-19-21/h5-9H,10-11H2,1-4H3 |
| InChIKey | NSOMNKIAJGRLSH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|