About [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate
[4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate (PubChem CID 54128762) has the molecular formula C27H36O2
and a molecular weight of 392.58 g/mol. Its IUPAC name is [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate |
| PubChem CID | 54128762 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate |
| SMILES | CCCC1CCC(C=CC#CC2CCC(OC(=O)c3ccc(C)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H36O2/c1-3-6-22-11-13-23(14-12-22)7-4-5-8-24-15-19-26(20-16-24)29-27(28)25-17-9-21(2)10-18-25/h4,7,9-10,17-18,22-24,26H,3,6,11-16,19-20H2,1-2H3 |
| InChIKey | NSUSUGXINWSVCS-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate?
The IUPAC name of [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate (CID 54128762) is [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate.
What is the SMILES notation for [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate?
The canonical SMILES for [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate is CCCC1CCC(C=CC#CC2CCC(OC(=O)c3ccc(C)cc3)CC2)CC1.
What is the InChIKey of [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate?
The InChIKey is NSUSUGXINWSVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36O2/c1-3-6-22-11-13-23(14-12-22)7-4-5-8-24-15-19-26(20-16-24)29-27(28)25-17-9-21(2)10-18-25/h4,7,9-10,17-18,22-24,26H,3,6,11-16,19-20H2,1-2H3.
What are the key properties of [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate?
[4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate has a molecular weight of 392.58 g/mol, XLogP of 6.88, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4-propylcyclohexyl)but-3-en-1-ynyl]cyclohexyl] 4-methylbenzoate is sourced from PubChem (CID 54128762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).