About 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one
7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one (PubChem CID 54128793) has the molecular formula C16H12N2O2
and a molecular weight of 264.28 g/mol. Its IUPAC name is 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one.
Molecular Properties
| Compound Name | 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one |
| PubChem CID | 54128793 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one |
| SMILES | CN1C(=O)c2[nH]c3ccccc3c2Oc2ccccc21 |
| InChI | InChI=1S/C16H12N2O2/c1-18-12-8-4-5-9-13(12)20-15-10-6-2-3-7-11(10)17-14(15)16(18)19/h2-9,17H,1H3 |
| InChIKey | NSVKUOCQNTVVKV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one?
The IUPAC name of 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one (CID 54128793) is 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one.
What is the SMILES notation for 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one?
The canonical SMILES for 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one is CN1C(=O)c2[nH]c3ccccc3c2Oc2ccccc21.
What is the InChIKey of 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one?
The InChIKey is NSVKUOCQNTVVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2/c1-18-12-8-4-5-9-13(12)20-15-10-6-2-3-7-11(10)17-14(15)16(18)19/h2-9,17H,1H3.
What are the key properties of 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one?
7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one has a molecular weight of 264.28 g/mol, XLogP of 3.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5H-indolo[3,2-b][1,5]benzoxazepin-6-one is sourced from PubChem (CID 54128793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).