About 3-fluoro-3,4-dihydro-1H-pyridin-2-one
3-fluoro-3,4-dihydro-1H-pyridin-2-one (PubChem CID 54128847) has the molecular formula C5H6FNO
and a molecular weight of 115.11 g/mol. Its IUPAC name is 3-fluoro-3,4-dihydro-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-fluoro-3,4-dihydro-1H-pyridin-2-one |
| PubChem CID | 54128847 |
| Molecular Formula | C5H6FNO |
| Molecular Weight | 115.11 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 3-fluoro-3,4-dihydro-1H-pyridin-2-one |
| SMILES | O=C1NC=CCC1F |
| InChI | InChI=1S/C5H6FNO/c6-4-2-1-3-7-5(4)8/h1,3-4H,2H2,(H,7,8) |
| InChIKey | NSWKCPZOHFQXJC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.11 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-3,4-dihydro-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3,4-dihydro-1H-pyridin-2-one?
The IUPAC name of 3-fluoro-3,4-dihydro-1H-pyridin-2-one (CID 54128847) is 3-fluoro-3,4-dihydro-1H-pyridin-2-one.
What is the SMILES notation for 3-fluoro-3,4-dihydro-1H-pyridin-2-one?
The canonical SMILES for 3-fluoro-3,4-dihydro-1H-pyridin-2-one is O=C1NC=CCC1F.
What is the InChIKey of 3-fluoro-3,4-dihydro-1H-pyridin-2-one?
The InChIKey is NSWKCPZOHFQXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FNO/c6-4-2-1-3-7-5(4)8/h1,3-4H,2H2,(H,7,8).
What are the key properties of 3-fluoro-3,4-dihydro-1H-pyridin-2-one?
3-fluoro-3,4-dihydro-1H-pyridin-2-one has a molecular weight of 115.11 g/mol, XLogP of 0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3,4-dihydro-1H-pyridin-2-one is sourced from PubChem (CID 54128847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).