C13H17N3O4S — CID 54128900
2-(4-imidazol-1-ylphenoxy)ethyl N,N-dimethylsulfamate (PubChem CID 54128900) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-(4-imidazol-1-ylphenoxy)ethyl N,N-dimethylsulfamate.
| Compound Name | 2-(4-imidazol-1-ylphenoxy)ethyl N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 54128900 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-(4-imidazol-1-ylphenoxy)ethyl N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)OCCOc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C13H17N3O4S/c1-15(2)21(17,18)20-10-9-19-13-5-3-12(4-6-13)16-8-7-14-11-16/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | NSXKXORGABLUAP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|