C22H20Cl4F3NO3 — CID 54129520
1-[4-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethyl]phenyl]-2,2,2-trifluoro-N-propoxyethanimine (PubChem CID 54129520) has the molecular formula C22H20Cl4F3NO3 and a molecular weight of 545.21 g/mol. Its IUPAC name is 1-[4-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethyl]phenyl]-2,2,2-trifluoro-N-propoxyethanimine.
| Compound Name | 1-[4-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethyl]phenyl]-2,2,2-trifluoro-N-propoxyethanimine |
|---|---|
| PubChem CID | 54129520 |
| Molecular Formula | C22H20Cl4F3NO3 |
| Molecular Weight | 545.21 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | 1-[4-[2-[2,6-dichloro-4-(3,3-dichloroprop-2-enoxy)phenoxy]ethyl]phenyl]-2,2,2-trifluoro-N-propoxyethanimine |
| SMILES | CCCON=C(c1ccc(CCOc2c(Cl)cc(OCC=C(Cl)Cl)cc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H20Cl4F3NO3/c1-2-9-33-30-21(22(27,28)29)15-5-3-14(4-6-15)7-10-32-20-17(23)12-16(13-18(20)24)31-11-8-19(25)26/h3-6,8,12-13H,2,7,9-11H2,1H3 |
| InChIKey | NTJAYEMALMFULN-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.21 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|