C21H20O5 — CID 54129732
6-(4-oxo-3-phenylchromen-7-yl)oxyhexanoic acid (PubChem CID 54129732) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 6-(4-oxo-3-phenylchromen-7-yl)oxyhexanoic acid.
| Compound Name | 6-(4-oxo-3-phenylchromen-7-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 54129732 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 6-(4-oxo-3-phenylchromen-7-yl)oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccc2c(=O)c(-c3ccccc3)coc2c1 |
| InChI | InChI=1S/C21H20O5/c22-20(23)9-5-2-6-12-25-16-10-11-17-19(13-16)26-14-18(21(17)24)15-7-3-1-4-8-15/h1,3-4,7-8,10-11,13-14H,2,5-6,9,12H2,(H,22,23) |
| InChIKey | NTMRNGALJKIXQQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|