C29H26N2OS — CID 54130446
1-(3,4-dimethylthiophen-2-yl)-1-(1H-imidazol-5-yl)-2,2,2-triphenylethanol (PubChem CID 54130446) has the molecular formula C29H26N2OS and a molecular weight of 450.61 g/mol. Its IUPAC name is 1-(3,4-dimethylthiophen-2-yl)-1-(1H-imidazol-5-yl)-2,2,2-triphenylethanol.
| Compound Name | 1-(3,4-dimethylthiophen-2-yl)-1-(1H-imidazol-5-yl)-2,2,2-triphenylethanol |
|---|---|
| PubChem CID | 54130446 |
| Molecular Formula | C29H26N2OS |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-(3,4-dimethylthiophen-2-yl)-1-(1H-imidazol-5-yl)-2,2,2-triphenylethanol |
| SMILES | Cc1csc(C(O)(c2cnc[nH]2)C(c2ccccc2)(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C29H26N2OS/c1-21-19-33-27(22(21)2)29(32,26-18-30-20-31-26)28(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-20,32H,1-2H3,(H,30,31) |
| InChIKey | NTYUGOSYOBDCLX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|