C12H22F2O5Si — CID 54130462
methyl (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-trimethylsilyloxypropanoate (PubChem CID 54130462) has the molecular formula C12H22F2O5Si and a molecular weight of 312.39 g/mol. Its IUPAC name is methyl (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-trimethylsilyloxypropanoate.
| Compound Name | methyl (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-trimethylsilyloxypropanoate |
|---|---|
| PubChem CID | 54130462 |
| Molecular Formula | C12H22F2O5Si |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl (3R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-trimethylsilyloxypropanoate |
| SMILES | COC(=O)C(F)(F)[C@H](O[Si](C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H22F2O5Si/c1-11(2)17-7-8(18-11)9(19-20(4,5)6)12(13,14)10(15)16-3/h8-9H,7H2,1-6H3/t8-,9-/m1/s1 |
| InChIKey | NTZBACCKAIIIPC-RKDXNWHRSA-N |
| XLogP | 2.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|