C12H18N2O4S — CID 54130469
[2-(butylcarbamoyl)-4-methylphenyl]sulfamic acid (PubChem CID 54130469) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is [2-(butylcarbamoyl)-4-methylphenyl]sulfamic acid.
| Compound Name | [2-(butylcarbamoyl)-4-methylphenyl]sulfamic acid |
|---|---|
| PubChem CID | 54130469 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | [2-(butylcarbamoyl)-4-methylphenyl]sulfamic acid |
| SMILES | CCCCNC(=O)c1cc(C)ccc1NS(=O)(=O)O |
| InChI | InChI=1S/C12H18N2O4S/c1-3-4-7-13-12(15)10-8-9(2)5-6-11(10)14-19(16,17)18/h5-6,8,14H,3-4,7H2,1-2H3,(H,13,15)(H,16,17,18) |
| InChIKey | NTZFMIJFWODAEC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|