C28H33N7O — CID 54130556
N-[3-[3-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]propyl-methylamino]propyl]-2,2-diphenylacetamide (PubChem CID 54130556) has the molecular formula C28H33N7O and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[3-[3-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]propyl-methylamino]propyl]-2,2-diphenylacetamide.
| Compound Name | N-[3-[3-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]propyl-methylamino]propyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 54130556 |
| Molecular Formula | C28H33N7O |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | N-[3-[3-[cyano-(N'-pyridin-4-ylcarbamimidoyl)amino]propyl-methylamino]propyl]-2,2-diphenylacetamide |
| SMILES | CN(CCCNC(=O)C(c1ccccc1)c1ccccc1)CCCN(C#N)/C(N)=N/c1ccncc1 |
| InChI | InChI=1S/C28H33N7O/c1-34(20-9-21-35(22-29)28(30)33-25-14-17-31-18-15-25)19-8-16-32-27(36)26(23-10-4-2-5-11-23)24-12-6-3-7-13-24/h2-7,10-15,17-18,26H,8-9,16,19-21H2,1H3,(H,32,36)(H2,30,31,33) |
| InChIKey | NUAWZPGKVCDCGL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|