About prop-1-enylurea
prop-1-enylurea (PubChem CID 54130800) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is prop-1-enylurea.
Molecular Properties
| Compound Name | prop-1-enylurea |
| PubChem CID | 54130800 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | prop-1-enylurea |
| SMILES | CC=CNC(N)=O |
| InChI | InChI=1S/C4H8N2O/c1-2-3-6-4(5)7/h2-3H,1H3,(H3,5,6,7) |
| InChIKey | SKXUZVAWHSXDRT-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze prop-1-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-enylurea?
The IUPAC name of prop-1-enylurea (CID 54130800) is prop-1-enylurea.
What is the SMILES notation for prop-1-enylurea?
The canonical SMILES for prop-1-enylurea is CC=CNC(N)=O.
What is the InChIKey of prop-1-enylurea?
The InChIKey is SKXUZVAWHSXDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O/c1-2-3-6-4(5)7/h2-3H,1H3,(H3,5,6,7).
What are the key properties of prop-1-enylurea?
prop-1-enylurea has a molecular weight of 100.12 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-enylurea is sourced from PubChem (CID 54130800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).