About 2-methylpentan-3-imine
2-methylpentan-3-imine (PubChem CID 54130897) has the molecular formula C6H13N
and a molecular weight of 99.18 g/mol. Its IUPAC name is 2-methylpentan-3-imine.
Molecular Properties
| Compound Name | 2-methylpentan-3-imine |
| PubChem CID | 54130897 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | 2-methylpentan-3-imine |
| SMILES | [H]/N=C(\CC)C(C)C |
| InChI | InChI=1S/C6H13N/c1-4-6(7)5(2)3/h5,7H,4H2,1-3H3/b7-6+ |
| InChIKey | NUHBRVWOAVDFMV-VOTSOKGWSA-N |
| XLogP | 2.07 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentan-3-imine?
The IUPAC name of 2-methylpentan-3-imine (CID 54130897) is 2-methylpentan-3-imine.
What is the SMILES notation for 2-methylpentan-3-imine?
The canonical SMILES for 2-methylpentan-3-imine is [H]/N=C(\CC)C(C)C.
What is the InChIKey of 2-methylpentan-3-imine?
The InChIKey is NUHBRVWOAVDFMV-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H13N/c1-4-6(7)5(2)3/h5,7H,4H2,1-3H3/b7-6+.
What are the key properties of 2-methylpentan-3-imine?
2-methylpentan-3-imine has a molecular weight of 99.18 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentan-3-imine is sourced from PubChem (CID 54130897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).