C16H19F5OS — CID 54131133
[4-[2-(4-ethoxycyclohexyl)-1,1,2,2-tetrafluoroethyl]phenyl] thiohypofluorite (PubChem CID 54131133) has the molecular formula C16H19F5OS and a molecular weight of 354.38 g/mol. Its IUPAC name is [4-[2-(4-ethoxycyclohexyl)-1,1,2,2-tetrafluoroethyl]phenyl] thiohypofluorite.
| Compound Name | [4-[2-(4-ethoxycyclohexyl)-1,1,2,2-tetrafluoroethyl]phenyl] thiohypofluorite |
|---|---|
| PubChem CID | 54131133 |
| Molecular Formula | C16H19F5OS |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [4-[2-(4-ethoxycyclohexyl)-1,1,2,2-tetrafluoroethyl]phenyl] thiohypofluorite |
| SMILES | CCOC1CCC(C(F)(F)C(F)(F)c2ccc(SF)cc2)CC1 |
| InChI | InChI=1S/C16H19F5OS/c1-2-22-13-7-3-11(4-8-13)15(17,18)16(19,20)12-5-9-14(23-21)10-6-12/h5-6,9-11,13H,2-4,7-8H2,1H3 |
| InChIKey | NULRUFUPTQBXCF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|