About 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide
8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide (PubChem CID 54131272) has the molecular formula C13H11NO3S
and a molecular weight of 261.30 g/mol. Its IUPAC name is 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide.
Molecular Properties
| Compound Name | 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide |
| PubChem CID | 54131272 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide |
| SMILES | COc1ccc2c(c1)NS(=O)(=O)c1ccccc1-2 |
| InChI | InChI=1S/C13H11NO3S/c1-17-9-6-7-10-11-4-2-3-5-13(11)18(15,16)14-12(10)8-9/h2-8,14H,1H3 |
| InChIKey | NUNWMUWKOLDXAU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide?
The IUPAC name of 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide (CID 54131272) is 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide.
What is the SMILES notation for 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide?
The canonical SMILES for 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide is COc1ccc2c(c1)NS(=O)(=O)c1ccccc1-2.
What is the InChIKey of 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide?
The InChIKey is NUNWMUWKOLDXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3S/c1-17-9-6-7-10-11-4-2-3-5-13(11)18(15,16)14-12(10)8-9/h2-8,14H,1H3.
What are the key properties of 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide?
8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide has a molecular weight of 261.30 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-6H-benzo[c][1,2]benzothiazine 5,5-dioxide is sourced from PubChem (CID 54131272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).