C12H14O3 — CID 54131775
5a,8,9,9a,10,10a-hexahydro-4aH-pyrano[4,3-b]chromen-1-one (PubChem CID 54131775) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5a,8,9,9a,10,10a-hexahydro-4aH-pyrano[4,3-b]chromen-1-one.
| Compound Name | 5a,8,9,9a,10,10a-hexahydro-4aH-pyrano[4,3-b]chromen-1-one |
|---|---|
| PubChem CID | 54131775 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5a,8,9,9a,10,10a-hexahydro-4aH-pyrano[4,3-b]chromen-1-one |
| SMILES | O=C1OC=CC2OC3C=CCCC3CC12 |
| InChI | InChI=1S/C12H14O3/c13-12-9-7-8-3-1-2-4-10(8)15-11(9)5-6-14-12/h2,4-6,8-11H,1,3,7H2 |
| InChIKey | NUWGUSZWSKSWPL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|