C21H26Cl2N2O6 — CID 54131952
2-[[5-[5-[2,6-dichloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl]-1,2-oxazol-3-yl]-methoxymethoxy]ethanol (PubChem CID 54131952) has the molecular formula C21H26Cl2N2O6 and a molecular weight of 473.35 g/mol. Its IUPAC name is 2-[[5-[5-[2,6-dichloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl]-1,2-oxazol-3-yl]-methoxymethoxy]ethanol.
| Compound Name | 2-[[5-[5-[2,6-dichloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl]-1,2-oxazol-3-yl]-methoxymethoxy]ethanol |
|---|---|
| PubChem CID | 54131952 |
| Molecular Formula | C21H26Cl2N2O6 |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[[5-[5-[2,6-dichloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl]-1,2-oxazol-3-yl]-methoxymethoxy]ethanol |
| SMILES | COC(OCCO)c1cc(CCCCCOc2c(Cl)cc(C3=NCCO3)cc2Cl)on1 |
| InChI | InChI=1S/C21H26Cl2N2O6/c1-27-21(30-10-7-26)18-13-15(31-25-18)5-3-2-4-8-28-19-16(22)11-14(12-17(19)23)20-24-6-9-29-20/h11-13,21,26H,2-10H2,1H3 |
| InChIKey | NUZHCPBKUOSUIV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 95.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|