C17H22N3O2+ — CID 54131992
1-methyl-2-(nitrosomethyl)-3-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxymethyl)imidazol-1-ium (PubChem CID 54131992) has the molecular formula C17H22N3O2+ and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-methyl-2-(nitrosomethyl)-3-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxymethyl)imidazol-1-ium.
| Compound Name | 1-methyl-2-(nitrosomethyl)-3-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxymethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 54131992 |
| Molecular Formula | C17H22N3O2+ |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-methyl-2-(nitrosomethyl)-3-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxymethyl)imidazol-1-ium |
| SMILES | C[n+]1ccn(COCC2CCCc3ccccc32)c1CN=O |
| InChI | InChI=1S/C17H22N3O2/c1-19-9-10-20(17(19)11-18-21)13-22-12-15-7-4-6-14-5-2-3-8-16(14)15/h2-3,5,8-10,15H,4,6-7,11-13H2,1H3/q+1 |
| InChIKey | NVAAQFULNGKHHE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|