About spiro[4H-isoquinoline-1,1'-cyclohexane]
spiro[4H-isoquinoline-1,1'-cyclohexane] (PubChem CID 54132846) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is spiro[4H-isoquinoline-1,1'-cyclohexane].
Molecular Properties
| Compound Name | spiro[4H-isoquinoline-1,1'-cyclohexane] |
| PubChem CID | 54132846 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | spiro[4H-isoquinoline-1,1'-cyclohexane] |
| SMILES | C1=NC2(CCCCC2)c2ccccc2C1 |
| InChI | InChI=1S/C14H17N/c1-4-9-14(10-5-1)13-7-3-2-6-12(13)8-11-15-14/h2-3,6-7,11H,1,4-5,8-10H2 |
| InChIKey | NVOHUKWBNZJNTL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[4H-isoquinoline-1,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4H-isoquinoline-1,1'-cyclohexane]?
The IUPAC name of spiro[4H-isoquinoline-1,1'-cyclohexane] (CID 54132846) is spiro[4H-isoquinoline-1,1'-cyclohexane].
What is the SMILES notation for spiro[4H-isoquinoline-1,1'-cyclohexane]?
The canonical SMILES for spiro[4H-isoquinoline-1,1'-cyclohexane] is C1=NC2(CCCCC2)c2ccccc2C1.
What is the InChIKey of spiro[4H-isoquinoline-1,1'-cyclohexane]?
The InChIKey is NVOHUKWBNZJNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N/c1-4-9-14(10-5-1)13-7-3-2-6-12(13)8-11-15-14/h2-3,6-7,11H,1,4-5,8-10H2.
What are the key properties of spiro[4H-isoquinoline-1,1'-cyclohexane]?
spiro[4H-isoquinoline-1,1'-cyclohexane] has a molecular weight of 199.30 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4H-isoquinoline-1,1'-cyclohexane] is sourced from PubChem (CID 54132846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).