C9H11F2IN2S — CID 54133268
5-(4,4-difluorobut-3-enylsulfanyl)-4-iodo-1,3-dimethylpyrazole (PubChem CID 54133268) has the molecular formula C9H11F2IN2S and a molecular weight of 344.17 g/mol. Its IUPAC name is 5-(4,4-difluorobut-3-enylsulfanyl)-4-iodo-1,3-dimethylpyrazole.
| Compound Name | 5-(4,4-difluorobut-3-enylsulfanyl)-4-iodo-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 54133268 |
| Molecular Formula | C9H11F2IN2S |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 5-(4,4-difluorobut-3-enylsulfanyl)-4-iodo-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(SCCC=C(F)F)c1I |
| InChI | InChI=1S/C9H11F2IN2S/c1-6-8(12)9(14(2)13-6)15-5-3-4-7(10)11/h4H,3,5H2,1-2H3 |
| InChIKey | NVVVUNGHYOZDIE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|