C17H19N — CID 54133361
(4R)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 54133361) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is (4R)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (4R)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 54133361 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (4R)-N-methyl-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CNC1CC[C@H](c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H19N/c1-18-17-12-11-14(13-7-3-2-4-8-13)15-9-5-6-10-16(15)17/h2-10,14,17-18H,11-12H2,1H3/t14-,17?/m1/s1 |
| InChIKey | NVXPZMLRGBVYQV-XPCCGILXSA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |