About 5-(methoxymethyl)-2,4-dimethylpyrimidine
5-(methoxymethyl)-2,4-dimethylpyrimidine (PubChem CID 54133369) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-(methoxymethyl)-2,4-dimethylpyrimidine.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-2,4-dimethylpyrimidine |
| PubChem CID | 54133369 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 5-(methoxymethyl)-2,4-dimethylpyrimidine |
| SMILES | COCc1cnc(C)nc1C |
| InChI | InChI=1S/C8H12N2O/c1-6-8(5-11-3)4-9-7(2)10-6/h4H,5H2,1-3H3 |
| InChIKey | NVXUODMNFLYTRX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(methoxymethyl)-2,4-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-2,4-dimethylpyrimidine?
The IUPAC name of 5-(methoxymethyl)-2,4-dimethylpyrimidine (CID 54133369) is 5-(methoxymethyl)-2,4-dimethylpyrimidine.
What is the SMILES notation for 5-(methoxymethyl)-2,4-dimethylpyrimidine?
The canonical SMILES for 5-(methoxymethyl)-2,4-dimethylpyrimidine is COCc1cnc(C)nc1C.
What is the InChIKey of 5-(methoxymethyl)-2,4-dimethylpyrimidine?
The InChIKey is NVXUODMNFLYTRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-8(5-11-3)4-9-7(2)10-6/h4H,5H2,1-3H3.
What are the key properties of 5-(methoxymethyl)-2,4-dimethylpyrimidine?
5-(methoxymethyl)-2,4-dimethylpyrimidine has a molecular weight of 152.20 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-2,4-dimethylpyrimidine is sourced from PubChem (CID 54133369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).