C21H30N4O2 — CID 54133541
2-[[4-[5-(diethylamino)-2-pyridinyl]piperazin-1-yl]methyl]-4-methoxyphenol (PubChem CID 54133541) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-[[4-[5-(diethylamino)-2-pyridinyl]piperazin-1-yl]methyl]-4-methoxyphenol.
| Compound Name | 2-[[4-[5-(diethylamino)-2-pyridinyl]piperazin-1-yl]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 54133541 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 2-[[4-[5-(diethylamino)-2-pyridinyl]piperazin-1-yl]methyl]-4-methoxyphenol |
| SMILES | CCN(CC)c1ccc(N2CCN(Cc3cc(OC)ccc3O)CC2)nc1 |
| InChI | InChI=1S/C21H30N4O2/c1-4-24(5-2)18-6-9-21(22-15-18)25-12-10-23(11-13-25)16-17-14-19(27-3)7-8-20(17)26/h6-9,14-15,26H,4-5,10-13,16H2,1-3H3 |
| InChIKey | NWBCAZXOEHARHF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|