C22H22N7O5S2+ — CID 54133617
(6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-(imidazo[1,5-a]pyridin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54133617) has the molecular formula C22H22N7O5S2+ and a molecular weight of 528.60 g/mol. Its IUPAC name is (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-(imidazo[1,5-a]pyridin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-(imidazo[1,5-a]pyridin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54133617 |
| Molecular Formula | C22H22N7O5S2+ |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (6S,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-ethoxyiminoacetyl]amino]-3-(imidazo[1,5-a]pyridin-2-ium-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(C[n+]3cc4ccccn4c3)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C22H21N7O5S2/c1-2-34-26-15(14-10-36-22(23)24-14)18(30)25-16-19(31)29-17(21(32)33)12(9-35-20(16)29)7-27-8-13-5-3-4-6-28(13)11-27/h3-6,8,10-11,16,20H,2,7,9H2,1H3,(H3-,23,24,25,30,32,33)/p+1/t16-,20+/m1/s1 |
| InChIKey | NWCGKYUMJMMTMZ-UZLBHIALSA-O |
| XLogP | 0.44 |
| TPSA | 155.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|