C23H34O3 — CID 54133640
[3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-hydroxypropanoate (PubChem CID 54133640) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-hydroxypropanoate.
| Compound Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 54133640 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] 2-hydroxypropanoate |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CCOC(=O)C(C)O |
| InChI | InChI=1S/C23H34O3/c1-17(12-13-21-19(3)11-8-15-23(21,5)6)9-7-10-18(2)14-16-26-22(25)20(4)24/h7,9-10,12-14,20,24H,8,11,15-16H2,1-6H3 |
| InChIKey | NWCRUQHRCQTZRM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|