About spiro[adamantane-2,2'-pyrano[2,3-c]pyridine]
spiro[adamantane-2,2'-pyrano[2,3-c]pyridine] (PubChem CID 54133864) has the molecular formula C17H19NO
and a molecular weight of 253.34 g/mol. Its IUPAC name is spiro[adamantane-2,2'-pyrano[2,3-c]pyridine].
Molecular Properties
| Compound Name | spiro[adamantane-2,2'-pyrano[2,3-c]pyridine] |
| PubChem CID | 54133864 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | spiro[adamantane-2,2'-pyrano[2,3-c]pyridine] |
| SMILES | C1=CC2(Oc3cnccc31)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C17H19NO/c1-3-17(19-16-10-18-4-2-13(1)16)14-6-11-5-12(8-14)9-15(17)7-11/h1-4,10-12,14-15H,5-9H2 |
| InChIKey | NWGMPJAWOOYRKG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[adamantane-2,2'-pyrano[2,3-c]pyridine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[adamantane-2,2'-pyrano[2,3-c]pyridine]?
The IUPAC name of spiro[adamantane-2,2'-pyrano[2,3-c]pyridine] (CID 54133864) is spiro[adamantane-2,2'-pyrano[2,3-c]pyridine].
What is the SMILES notation for spiro[adamantane-2,2'-pyrano[2,3-c]pyridine]?
The canonical SMILES for spiro[adamantane-2,2'-pyrano[2,3-c]pyridine] is C1=CC2(Oc3cnccc31)C1CC3CC(C1)CC2C3.
What is the InChIKey of spiro[adamantane-2,2'-pyrano[2,3-c]pyridine]?
The InChIKey is NWGMPJAWOOYRKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO/c1-3-17(19-16-10-18-4-2-13(1)16)14-6-11-5-12(8-14)9-15(17)7-11/h1-4,10-12,14-15H,5-9H2.
What are the key properties of spiro[adamantane-2,2'-pyrano[2,3-c]pyridine]?
spiro[adamantane-2,2'-pyrano[2,3-c]pyridine] has a molecular weight of 253.34 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[adamantane-2,2'-pyrano[2,3-c]pyridine] is sourced from PubChem (CID 54133864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).