C19H36O4Si — CID 54135032
(3aR,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxypropan-2-yloxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 54135032) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (3aR,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxypropan-2-yloxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aR,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxypropan-2-yloxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 54135032 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (3aR,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxypropan-2-yloxymethyl)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | COC(C)(C)OCC1C(O[Si](C)(C)C(C)(C)C)C[C@H]2CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C19H36O4Si/c1-18(2,3)24(7,8)23-17-10-13-9-14(20)11-15(13)16(17)12-22-19(4,5)21-6/h13,15-17H,9-12H2,1-8H3/t13-,15-,16?,17?/m1/s1 |
| InChIKey | NXBXQDJZSDMLCV-PMRDFSHISA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|