About (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate
(3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate (PubChem CID 54135079) has the molecular formula C13H13F3O4S
and a molecular weight of 322.30 g/mol. Its IUPAC name is (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate |
| PubChem CID | 54135079 |
| Molecular Formula | C13H13F3O4S |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate |
| SMILES | CCCC1Cc2cccc(OS(=O)(=O)C(F)(F)F)c2C1=O |
| InChI | InChI=1S/C13H13F3O4S/c1-2-4-9-7-8-5-3-6-10(11(8)12(9)17)20-21(18,19)13(14,15)16/h3,5-6,9H,2,4,7H2,1H3 |
| InChIKey | NXCQXIJEVLVXMZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate?
The IUPAC name of (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate (CID 54135079) is (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate is CCCC1Cc2cccc(OS(=O)(=O)C(F)(F)F)c2C1=O.
What is the InChIKey of (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate?
The InChIKey is NXCQXIJEVLVXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3O4S/c1-2-4-9-7-8-5-3-6-10(11(8)12(9)17)20-21(18,19)13(14,15)16/h3,5-6,9H,2,4,7H2,1H3.
What are the key properties of (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate?
(3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate has a molecular weight of 322.30 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-2-propyl-1,2-dihydroinden-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 54135079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).