C15H14N2O2 — CID 54135100
3,6-bis(methylamino)xanthen-9-one (PubChem CID 54135100) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3,6-bis(methylamino)xanthen-9-one.
| Compound Name | 3,6-bis(methylamino)xanthen-9-one |
|---|---|
| PubChem CID | 54135100 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3,6-bis(methylamino)xanthen-9-one |
| SMILES | CNc1ccc2c(=O)c3ccc(NC)cc3oc2c1 |
| InChI | InChI=1S/C15H14N2O2/c1-16-9-3-5-11-13(7-9)19-14-8-10(17-2)4-6-12(14)15(11)18/h3-8,16-17H,1-2H3 |
| InChIKey | NXCYCMQGJAPCCL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|