About 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol
2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol (PubChem CID 541356) has the molecular formula C17H11BrCl2FNO
and a molecular weight of 415.09 g/mol. Its IUPAC name is 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol |
| PubChem CID | 541356 |
| Molecular Formula | C17H11BrCl2FNO |
| Molecular Weight | 415.09 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol |
| SMILES | OC(CBr)c1cc(-c2ccc(F)cc2)nc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C17H11BrCl2FNO/c18-8-16(23)12-7-15(9-1-3-11(21)4-2-9)22-17-13(12)5-10(19)6-14(17)20/h1-7,16,23H,8H2 |
| InChIKey | IIHTYRRGPSKHJP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.09 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol?
The IUPAC name of 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol (CID 541356) is 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol.
What is the SMILES notation for 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol?
The canonical SMILES for 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol is OC(CBr)c1cc(-c2ccc(F)cc2)nc2c(Cl)cc(Cl)cc12.
What is the InChIKey of 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol?
The InChIKey is IIHTYRRGPSKHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BrCl2FNO/c18-8-16(23)12-7-15(9-1-3-11(21)4-2-9)22-17-13(12)5-10(19)6-14(17)20/h1-7,16,23H,8H2.
What are the key properties of 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol?
2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol has a molecular weight of 415.09 g/mol, XLogP of 5.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol is sourced from PubChem (CID 541356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).