cyclohexyloxy(ethenyl)phosphinic acid

C8H15O3P — CID 54135664

IUPACcyclohexyloxy(ethenyl)phosphinic acid
SMILESC=CP(=O)(O)OC1CCCCC1
InChIInChI=1S/C8H15O3P/c1-2-12(9,10)11-8-6-4-3-5-7-8/h2,8H,1,3-7H2,(H,9,10)
InChIKeyNXMZLOYFTMPFAU-UHFFFAOYSA-N
MW190.18 g/mol
LogP2.66
Rot. Bonds3

About cyclohexyloxy(ethenyl)phosphinic acid

cyclohexyloxy(ethenyl)phosphinic acid (PubChem CID 54135664) has the molecular formula C8H15O3P and a molecular weight of 190.18 g/mol. Its IUPAC name is cyclohexyloxy(ethenyl)phosphinic acid.

Molecular Properties

Compound Namecyclohexyloxy(ethenyl)phosphinic acid
PubChem CID54135664
Molecular FormulaC8H15O3P
Molecular Weight190.18 g/mol
Exact Mass190.08
IUPAC Namecyclohexyloxy(ethenyl)phosphinic acid
SMILESC=CP(=O)(O)OC1CCCCC1
InChIInChI=1S/C8H15O3P/c1-2-12(9,10)11-8-6-4-3-5-7-8/h2,8H,1,3-7H2,(H,9,10)
InChIKeyNXMZLOYFTMPFAU-UHFFFAOYSA-N
XLogP2.66
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.18
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze cyclohexyloxy(ethenyl)phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexyloxy(ethenyl)phosphinic acid?
The IUPAC name of cyclohexyloxy(ethenyl)phosphinic acid (CID 54135664) is cyclohexyloxy(ethenyl)phosphinic acid.
What is the SMILES notation for cyclohexyloxy(ethenyl)phosphinic acid?
The canonical SMILES for cyclohexyloxy(ethenyl)phosphinic acid is C=CP(=O)(O)OC1CCCCC1.
What is the InChIKey of cyclohexyloxy(ethenyl)phosphinic acid?
The InChIKey is NXMZLOYFTMPFAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15O3P/c1-2-12(9,10)11-8-6-4-3-5-7-8/h2,8H,1,3-7H2,(H,9,10).
What are the key properties of cyclohexyloxy(ethenyl)phosphinic acid?
cyclohexyloxy(ethenyl)phosphinic acid has a molecular weight of 190.18 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyloxy(ethenyl)phosphinic acid is sourced from PubChem (CID 54135664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).