About 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate
2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate (PubChem CID 54135737) has the molecular formula C24H24ClN3O3
and a molecular weight of 437.93 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate.
Molecular Properties
| Compound Name | 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate |
| PubChem CID | 54135737 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate |
| SMILES | O=C(Nc1cccc2cccnc12)OCCN1CCC(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H24ClN3O3/c25-20-8-6-18(7-9-20)23(29)19-10-13-28(14-11-19)15-16-31-24(30)27-21-5-1-3-17-4-2-12-26-22(17)21/h1-9,12,19H,10-11,13-16H2,(H,27,30) |
| InChIKey | NXOHMSZHRNTVGW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate?
The IUPAC name of 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate (CID 54135737) is 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate.
What is the SMILES notation for 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate?
The canonical SMILES for 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate is O=C(Nc1cccc2cccnc12)OCCN1CCC(C(=O)c2ccc(Cl)cc2)CC1.
What is the InChIKey of 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate?
The InChIKey is NXOHMSZHRNTVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24ClN3O3/c25-20-8-6-18(7-9-20)23(29)19-10-13-28(14-11-19)15-16-31-24(30)27-21-5-1-3-17-4-2-12-26-22(17)21/h1-9,12,19H,10-11,13-16H2,(H,27,30).
What are the key properties of 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate?
2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate has a molecular weight of 437.93 g/mol, XLogP of 5.03, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorobenzoyl)piperidin-1-yl]ethyl N-quinolin-8-ylcarbamate is sourced from PubChem (CID 54135737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).