About 6-fluorohept-1-yne
6-fluorohept-1-yne (PubChem CID 54135747) has the molecular formula C7H11F
and a molecular weight of 114.16 g/mol. Its IUPAC name is 6-fluorohept-1-yne.
Molecular Properties
| Compound Name | 6-fluorohept-1-yne |
| PubChem CID | 54135747 |
| Molecular Formula | C7H11F |
| Molecular Weight | 114.16 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 6-fluorohept-1-yne |
| SMILES | C#CCCCC(C)F |
| InChI | InChI=1S/C7H11F/c1-3-4-5-6-7(2)8/h1,7H,4-6H2,2H3 |
| InChIKey | JZMIVTOIVREJFC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluorohept-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorohept-1-yne?
The IUPAC name of 6-fluorohept-1-yne (CID 54135747) is 6-fluorohept-1-yne.
What is the SMILES notation for 6-fluorohept-1-yne?
The canonical SMILES for 6-fluorohept-1-yne is C#CCCCC(C)F.
What is the InChIKey of 6-fluorohept-1-yne?
The InChIKey is JZMIVTOIVREJFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F/c1-3-4-5-6-7(2)8/h1,7H,4-6H2,2H3.
What are the key properties of 6-fluorohept-1-yne?
6-fluorohept-1-yne has a molecular weight of 114.16 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorohept-1-yne is sourced from PubChem (CID 54135747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).