About [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate
[4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 54135813) has the molecular formula C12H12F6O3S
and a molecular weight of 350.28 g/mol. Its IUPAC name is [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 54135813 |
| Molecular Formula | C12H12F6O3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | CCCC(c1ccc(OS(=O)(=O)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F6O3S/c1-2-3-10(11(13,14)15)8-4-6-9(7-5-8)21-22(19,20)12(16,17)18/h4-7,10H,2-3H2,1H3 |
| InChIKey | NXPORGBYNJMULE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate (CID 54135813) is [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate is CCCC(c1ccc(OS(=O)(=O)C(F)(F)F)cc1)C(F)(F)F.
What is the InChIKey of [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is NXPORGBYNJMULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F6O3S/c1-2-3-10(11(13,14)15)8-4-6-9(7-5-8)21-22(19,20)12(16,17)18/h4-7,10H,2-3H2,1H3.
What are the key properties of [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate?
[4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 350.28 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,1,1-trifluoropentan-2-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 54135813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).