C21H32O5 — CID 54135896
7-[(1R,2R)-2-(4-ethenyl-4-hydroxyhept-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid (PubChem CID 54135896) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4-ethenyl-4-hydroxyhept-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-(4-ethenyl-4-hydroxyhept-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 54135896 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 7-[(1R,2R)-2-(4-ethenyl-4-hydroxyhept-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
| SMILES | C=CC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O)CCC |
| InChI | InChI=1S/C21H32O5/c1-3-14-21(26,4-2)15-8-9-16-12-13-18(22)17(16)10-6-5-7-11-19(23)20(24)25/h4-6,8-9,16-17,19,23,26H,2-3,7,10-15H2,1H3,(H,24,25)/t16-,17+,19?,21?/m0/s1 |
| InChIKey | NXRCJKFEHOQTIZ-JPPFFPKXSA-N |
| XLogP | 3.42 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|