C15H17Cl2N5 — CID 54135948
4-(azepan-1-yl)-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine (PubChem CID 54135948) has the molecular formula C15H17Cl2N5 and a molecular weight of 338.24 g/mol. Its IUPAC name is 4-(azepan-1-yl)-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(azepan-1-yl)-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 54135948 |
| Molecular Formula | C15H17Cl2N5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-(azepan-1-yl)-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2cc(Cl)ccc2Cl)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C15H17Cl2N5/c16-10-5-6-12(17)11(9-10)13-19-14(18)21-15(20-13)22-7-3-1-2-4-8-22/h5-6,9H,1-4,7-8H2,(H2,18,19,20,21) |
| InChIKey | NXSAJDSUDJUTRP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |