C7H2Cl4O2 — CID 54135975
2,2,5,6-tetrachloro-1,3-benzodioxole (PubChem CID 54135975) has the molecular formula C7H2Cl4O2 and a molecular weight of 259.90 g/mol. Its IUPAC name is 2,2,5,6-tetrachloro-1,3-benzodioxole.
| Compound Name | 2,2,5,6-tetrachloro-1,3-benzodioxole |
|---|---|
| PubChem CID | 54135975 |
| Molecular Formula | C7H2Cl4O2 |
| Molecular Weight | 259.90 g/mol |
| Exact Mass | 257.88 |
| IUPAC Name | 2,2,5,6-tetrachloro-1,3-benzodioxole |
| SMILES | Clc1cc2c(cc1Cl)OC(Cl)(Cl)O2 |
| InChI | InChI=1S/C7H2Cl4O2/c8-3-1-5-6(2-4(3)9)13-7(10,11)12-5/h1-2H |
| InChIKey | NXSLWABVFSIZIO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|